C24H22F3NO4 — CID 166802496
[(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 3-(trifluoromethyl)benzoate (PubChem CID 166802496) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 166802496 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [(1S,13R)-8-methoxy-4-methyl-10-oxa-4-azatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8,14-tetraen-13-yl] 3-(trifluoromethyl)benzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](OC(=O)c4cccc(C(F)(F)F)c4)C=C[C@@]31CCN2C |
| InChI | InChI=1S/C24H22F3NO4/c1-28-11-10-23-9-8-16(31-22(29)14-4-3-5-15(12-14)24(25,26)27)13-19(23)32-21-18(30-2)7-6-17(28)20(21)23/h3-9,12,16,19H,10-11,13H2,1-2H3/t16-,19?,23-/m0/s1 |
| InChIKey | RLUFKZQDNAWXCY-BBXWKJALSA-N |
| XLogP | 4.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|