C25H23FN2O5 — CID 130439433
2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl 6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylate (PubChem CID 130439433) has the molecular formula C25H23FN2O5 and a molecular weight of 450.47 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl 6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylate.
| Compound Name | 2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl 6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 130439433 |
| Molecular Formula | C25H23FN2O5 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl 6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylate |
| SMILES | O=C(OCCOC(=O)[C@@H]1CCCN1)c1cccc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C25H23FN2O5/c26-18-8-12-20(13-9-18)33-19-10-6-17(7-11-19)21-3-1-4-23(28-21)25(30)32-16-15-31-24(29)22-5-2-14-27-22/h1,3-4,6-13,22,27H,2,5,14-16H2/t22-/m0/s1 |
| InChIKey | IZCJEDFGRASTAN-QFIPXVFZSA-N |
| XLogP | 4.13 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|