C9H12N2 — CID 130442067
methyl-(5-methylcyclohepta-1,3,6-trien-1-yl)diazene (PubChem CID 130442067) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is methyl-(5-methylcyclohepta-1,3,6-trien-1-yl)diazene.
| Compound Name | methyl-(5-methylcyclohepta-1,3,6-trien-1-yl)diazene |
|---|---|
| PubChem CID | 130442067 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | methyl-(5-methylcyclohepta-1,3,6-trien-1-yl)diazene |
| SMILES | C/N=N/C1=CC=CC(C)C=C1 |
| InChI | InChI=1S/C9H12N2/c1-8-4-3-5-9(7-6-8)11-10-2/h3-8H,1-2H3/b11-10+ |
| InChIKey | RZOYLDJGRGGCCL-ZHACJKMWSA-N |
| XLogP | 2.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|