C24H30ClF3N6O — CID 130444784
[4-[4-amino-3-[amino-[(1R)-1-[4-chloro-2-(trifluoromethyl)phenyl]ethyl]amino]phenyl]piperazin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 130444784) has the molecular formula C24H30ClF3N6O and a molecular weight of 510.99 g/mol. Its IUPAC name is [4-[4-amino-3-[amino-[(1R)-1-[4-chloro-2-(trifluoromethyl)phenyl]ethyl]amino]phenyl]piperazin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | [4-[4-amino-3-[amino-[(1R)-1-[4-chloro-2-(trifluoromethyl)phenyl]ethyl]amino]phenyl]piperazin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 130444784 |
| Molecular Formula | C24H30ClF3N6O |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [4-[4-amino-3-[amino-[(1R)-1-[4-chloro-2-(trifluoromethyl)phenyl]ethyl]amino]phenyl]piperazin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | C[C@H](c1ccc(Cl)cc1C(F)(F)F)N(N)c1cc(N2CCN(C(=O)[C@H]3CCCN3)CC2)ccc1N |
| InChI | InChI=1S/C24H30ClF3N6O/c1-15(18-6-4-16(25)13-19(18)24(26,27)28)34(30)22-14-17(5-7-20(22)29)32-9-11-33(12-10-32)23(35)21-3-2-8-31-21/h4-7,13-15,21,31H,2-3,8-12,29-30H2,1H3/t15-,21-/m1/s1 |
| InChIKey | SBACLXVRMCDXQW-QVKFZJNVSA-N |
| XLogP | 3.78 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|