C24H20ClF2IN4O6 — CID 130445363
7-[(4-chlorophenyl)methyl]-8-[3-[difluoro(iodo)methoxy]phenoxy]-1-(3-methoxy-2-oxopropyl)-3-methylpurine-2,6-dione (PubChem CID 130445363) has the molecular formula C24H20ClF2IN4O6 and a molecular weight of 660.80 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-[3-[difluoro(iodo)methoxy]phenoxy]-1-(3-methoxy-2-oxopropyl)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-[3-[difluoro(iodo)methoxy]phenoxy]-1-(3-methoxy-2-oxopropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 130445363 |
| Molecular Formula | C24H20ClF2IN4O6 |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.01 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-[3-[difluoro(iodo)methoxy]phenoxy]-1-(3-methoxy-2-oxopropyl)-3-methylpurine-2,6-dione |
| SMILES | COCC(=O)Cn1c(=O)c2c(nc(Oc3cccc(OC(F)(F)I)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C24H20ClF2IN4O6/c1-30-20-19(21(34)32(23(30)35)12-16(33)13-36-2)31(11-14-6-8-15(25)9-7-14)22(29-20)37-17-4-3-5-18(10-17)38-24(26,27)28/h3-10H,11-13H2,1-2H3 |
| InChIKey | LLOWCNHLWDAGMM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|