C16H25ClN4O3 — CID 130445391
2-[(4-chlorophenyl)methylamino]-N-[2-(2-hydroxyethoxy)ethyl]-3,3-bis(methylamino)prop-2-enamide (PubChem CID 130445391) has the molecular formula C16H25ClN4O3 and a molecular weight of 356.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-N-[2-(2-hydroxyethoxy)ethyl]-3,3-bis(methylamino)prop-2-enamide.
| Compound Name | 2-[(4-chlorophenyl)methylamino]-N-[2-(2-hydroxyethoxy)ethyl]-3,3-bis(methylamino)prop-2-enamide |
|---|---|
| PubChem CID | 130445391 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[(4-chlorophenyl)methylamino]-N-[2-(2-hydroxyethoxy)ethyl]-3,3-bis(methylamino)prop-2-enamide |
| SMILES | CNC(NC)=C(NCc1ccc(Cl)cc1)C(=O)NCCOCCO |
| InChI | InChI=1S/C16H25ClN4O3/c1-18-15(19-2)14(16(23)20-7-9-24-10-8-22)21-11-12-3-5-13(17)6-4-12/h3-6,18-19,21-22H,7-11H2,1-2H3,(H,20,23) |
| InChIKey | PXMMBMSVZQBOHZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|