C10H13ClO3 — CID 130446235
ethyl (1S,3R)-3-carbonochloridoylbicyclo[2.2.0]hexane-1-carboxylate (PubChem CID 130446235) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is ethyl (1S,3R)-3-carbonochloridoylbicyclo[2.2.0]hexane-1-carboxylate.
| Compound Name | ethyl (1S,3R)-3-carbonochloridoylbicyclo[2.2.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 130446235 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | ethyl (1S,3R)-3-carbonochloridoylbicyclo[2.2.0]hexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC1[C@H](C(=O)Cl)C2 |
| InChI | InChI=1S/C10H13ClO3/c1-2-14-9(13)10-4-3-7(10)6(5-10)8(11)12/h6-7H,2-5H2,1H3/t6-,7?,10+/m1/s1 |
| InChIKey | VXVIDBABGZTTDP-PYZQLQBXSA-N |
| XLogP | 1.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|