C15H14Cl3N5 — CID 130448023
N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]ethane-1,2-diamine (PubChem CID 130448023) has the molecular formula C15H14Cl3N5 and a molecular weight of 370.67 g/mol. Its IUPAC name is N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 130448023 |
| Molecular Formula | C15H14Cl3N5 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]ethane-1,2-diamine |
| SMILES | Clc1cc(Cl)cc(CNCCNc2nc3nc(Cl)ccc3[nH]2)c1 |
| InChI | InChI=1S/C15H14Cl3N5/c16-10-5-9(6-11(17)7-10)8-19-3-4-20-15-21-12-1-2-13(18)22-14(12)23-15/h1-2,5-7,19H,3-4,8H2,(H2,20,21,22,23) |
| InChIKey | MIYXAQMTJOFMTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|