C28H41BrNO2PS — CID 13044880
bromo-tributyl-[[1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-λ5-phosphane (PubChem CID 13044880) has the molecular formula C28H41BrNO2PS and a molecular weight of 566.59 g/mol. Its IUPAC name is bromo-tributyl-[[1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-λ5-phosphane.
| Compound Name | bromo-tributyl-[[1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 13044880 |
| Molecular Formula | C28H41BrNO2PS |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | bromo-tributyl-[[1-(4-methylphenyl)sulfonylindol-4-yl]methyl]-λ5-phosphane |
| SMILES | CCCCP(Br)(CCCC)(CCCC)Cc1cccc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H41BrNO2PS/c1-5-8-20-33(29,21-9-6-2,22-10-7-3)23-25-12-11-13-28-27(25)18-19-30(28)34(31,32)26-16-14-24(4)15-17-26/h11-19H,5-10,20-23H2,1-4H3 |
| InChIKey | ZPGACVBKEOAQHI-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|