C27H31NS — CID 130450318
7-[(5aR)-1,2-dimethyl-2,3,3a,5a,10b,10c-hexahydro-1H-indeno[5,4-b][1]benzothiol-3-yl]-2-ethyl-2,3-dihydro-1H-indole (PubChem CID 130450318) has the molecular formula C27H31NS and a molecular weight of 401.62 g/mol. Its IUPAC name is 7-[(5aR)-1,2-dimethyl-2,3,3a,5a,10b,10c-hexahydro-1H-indeno[5,4-b][1]benzothiol-3-yl]-2-ethyl-2,3-dihydro-1H-indole.
| Compound Name | 7-[(5aR)-1,2-dimethyl-2,3,3a,5a,10b,10c-hexahydro-1H-indeno[5,4-b][1]benzothiol-3-yl]-2-ethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 130450318 |
| Molecular Formula | C27H31NS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 7-[(5aR)-1,2-dimethyl-2,3,3a,5a,10b,10c-hexahydro-1H-indeno[5,4-b][1]benzothiol-3-yl]-2-ethyl-2,3-dihydro-1H-indole |
| SMILES | CCC1Cc2cccc(C3C(C)C(C)C4C3C=C[C@H]3Sc5ccccc5C43)c2N1 |
| InChI | InChI=1S/C27H31NS/c1-4-18-14-17-8-7-10-21(27(17)28-18)24-15(2)16(3)25-20(24)12-13-23-26(25)19-9-5-6-11-22(19)29-23/h5-13,15-16,18,20,23-26,28H,4,14H2,1-3H3/t15?,16?,18?,20?,23-,24?,25?,26?/m1/s1 |
| InChIKey | UHUJXNWZSBEKMR-AJIGWSCSSA-N |
| XLogP | 6.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|