C23H27NS — CID 140801579
7-(1,2-dimethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzothiol-3-yl)-2,5-dimethyl-2,3-dihydro-1H-indole (PubChem CID 140801579) has the molecular formula C23H27NS and a molecular weight of 349.54 g/mol. Its IUPAC name is 7-(1,2-dimethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzothiol-3-yl)-2,5-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | 7-(1,2-dimethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzothiol-3-yl)-2,5-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 140801579 |
| Molecular Formula | C23H27NS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 7-(1,2-dimethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzothiol-3-yl)-2,5-dimethyl-2,3-dihydro-1H-indole |
| SMILES | Cc1cc2c(c(C3C(C)C(C)C4c5ccccc5SC43)c1)NC(C)C2 |
| InChI | InChI=1S/C23H27NS/c1-12-9-16-11-13(2)24-22(16)18(10-12)21-15(4)14(3)20-17-7-5-6-8-19(17)25-23(20)21/h5-10,13-15,20-21,23-24H,11H2,1-4H3 |
| InChIKey | VDANXLUWNONRHY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |