C14H26O3 — CID 130457269
2-(4-hydroxyoxan-4-yl)-2,4,4-trimethylhexan-3-one (PubChem CID 130457269) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(4-hydroxyoxan-4-yl)-2,4,4-trimethylhexan-3-one.
| Compound Name | 2-(4-hydroxyoxan-4-yl)-2,4,4-trimethylhexan-3-one |
|---|---|
| PubChem CID | 130457269 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-(4-hydroxyoxan-4-yl)-2,4,4-trimethylhexan-3-one |
| SMILES | CCC(C)(C)C(=O)C(C)(C)C1(O)CCOCC1 |
| InChI | InChI=1S/C14H26O3/c1-6-12(2,3)11(15)13(4,5)14(16)7-9-17-10-8-14/h16H,6-10H2,1-5H3 |
| InChIKey | QCVROPVOCADWRD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |