About ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one
ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one (PubChem CID 143188566) has the molecular formula C19H40O3
and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one.
Molecular Properties
| Compound Name | ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one |
| PubChem CID | 143188566 |
| Molecular Formula | C19H40O3 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one |
| SMILES | CC.CC.CC(=O)/C=C/C1(C)CCOCC1.CCC(C)(C)O |
| InChI | InChI=1S/C10H16O2.C5H12O.2C2H6/c1-9(11)3-4-10(2)5-7-12-8-6-10;1-4-5(2,3)6;2*1-2/h3-4H,5-8H2,1-2H3;6H,4H2,1-3H3;2*1-2H3/b4-3+;;; |
| InChIKey | IJDKBCRVXASKRI-FHJHGPAASA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one?
The IUPAC name of ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one (CID 143188566) is ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one.
What is the SMILES notation for ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one?
The canonical SMILES for ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one is CC.CC.CC(=O)/C=C/C1(C)CCOCC1.CCC(C)(C)O.
What is the InChIKey of ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one?
The InChIKey is IJDKBCRVXASKRI-FHJHGPAASA-N. The full InChI is InChI=1S/C10H16O2.C5H12O.2C2H6/c1-9(11)3-4-10(2)5-7-12-8-6-10;1-4-5(2,3)6;2*1-2/h3-4H,5-8H2,1-2H3;6H,4H2,1-3H3;2*1-2H3/b4-3+;;;.
What are the key properties of ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one?
ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one has a molecular weight of 316.53 g/mol, XLogP of 5.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutan-2-ol;(E)-4-(4-methyloxan-4-yl)but-3-en-2-one is sourced from PubChem (CID 143188566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).