About (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate
(7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate (PubChem CID 122606101) has the molecular formula C19H32ClNO4
and a molecular weight of 373.92 g/mol. Its IUPAC name is (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate |
| PubChem CID | 122606101 |
| Molecular Formula | C19H32ClNO4 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2(CCOCC2)N(Cl)C2(CCOCC2)C1 |
| InChI | InChI=1S/C19H32ClNO4/c1-4-17(2,3)16(22)25-15-13-18(5-9-23-10-6-18)21(20)19(14-15)7-11-24-12-8-19/h15H,4-14H2,1-3H3 |
| InChIKey | SHVQTDPQWVUNFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate?
The IUPAC name of (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate (CID 122606101) is (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1CC2(CCOCC2)N(Cl)C2(CCOCC2)C1.
What is the InChIKey of (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate?
The InChIKey is SHVQTDPQWVUNFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32ClNO4/c1-4-17(2,3)16(22)25-15-13-18(5-9-23-10-6-18)21(20)19(14-15)7-11-24-12-8-19/h15H,4-14H2,1-3H3.
What are the key properties of (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate?
(7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate has a molecular weight of 373.92 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 122606101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).