C19H32ClNO4 — CID 122606101
(7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate (PubChem CID 122606101) has the molecular formula C19H32ClNO4 and a molecular weight of 373.92 g/mol. Its IUPAC name is (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate.
| Compound Name | (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122606101 |
| Molecular Formula | C19H32ClNO4 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (7-chloro-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2(CCOCC2)N(Cl)C2(CCOCC2)C1 |
| InChI | InChI=1S/C19H32ClNO4/c1-4-17(2,3)16(22)25-15-13-18(5-9-23-10-6-18)21(20)19(14-15)7-11-24-12-8-19/h15H,4-14H2,1-3H3 |
| InChIKey | SHVQTDPQWVUNFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|