C35H67N3O5 — CID 159660553
1-butan-2-ylazepan-2-one;2-methyl-1-morpholin-4-ylbutan-1-one;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate (PubChem CID 159660553) has the molecular formula C35H67N3O5 and a molecular weight of 609.94 g/mol. Its IUPAC name is 1-butan-2-ylazepan-2-one;2-methyl-1-morpholin-4-ylbutan-1-one;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate.
| Compound Name | 1-butan-2-ylazepan-2-one;2-methyl-1-morpholin-4-ylbutan-1-one;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159660553 |
| Molecular Formula | C35H67N3O5 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 609.51 |
| IUPAC Name | 1-butan-2-ylazepan-2-one;2-methyl-1-morpholin-4-ylbutan-1-one;(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1.CCC(C)C(=O)N1CCOCC1.CCC(C)N1CCCCCC1=O |
| InChI | InChI=1S/C16H31NO2.C10H19NO.C9H17NO2/c1-9-14(2,3)13(18)19-12-10-15(4,5)17(8)16(6,7)11-12;1-3-9(2)11-8-6-4-5-7-10(11)12;1-3-8(2)9(11)10-4-6-12-7-5-10/h12H,9-11H2,1-8H3;9H,3-8H2,1-2H3;8H,3-7H2,1-2H3 |
| InChIKey | MSTAKXHVKLVCHA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |