C21H35NO6 — CID 88553753
oxiran-2-ylmethyl 4-acetyloxy-2-methyl-2-[2-(2-oxoazepan-1-yl)propyl]hexanoate (PubChem CID 88553753) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-acetyloxy-2-methyl-2-[2-(2-oxoazepan-1-yl)propyl]hexanoate.
| Compound Name | oxiran-2-ylmethyl 4-acetyloxy-2-methyl-2-[2-(2-oxoazepan-1-yl)propyl]hexanoate |
|---|---|
| PubChem CID | 88553753 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | oxiran-2-ylmethyl 4-acetyloxy-2-methyl-2-[2-(2-oxoazepan-1-yl)propyl]hexanoate |
| SMILES | CCC(CC(C)(CC(C)N1CCCCCC1=O)C(=O)OCC1CO1)OC(C)=O |
| InChI | InChI=1S/C21H35NO6/c1-5-17(28-16(3)23)12-21(4,20(25)27-14-18-13-26-18)11-15(2)22-10-8-6-7-9-19(22)24/h15,17-18H,5-14H2,1-4H3 |
| InChIKey | XWAYBRIFDLTGGU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|