C23H37NO3 — CID 20710380
(2-methyl-2-adamantyl) 2-ethyl-2-methyl-4-(2-oxopyrrolidin-1-yl)pentanoate (PubChem CID 20710380) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-ethyl-2-methyl-4-(2-oxopyrrolidin-1-yl)pentanoate.
| Compound Name | (2-methyl-2-adamantyl) 2-ethyl-2-methyl-4-(2-oxopyrrolidin-1-yl)pentanoate |
|---|---|
| PubChem CID | 20710380 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-ethyl-2-methyl-4-(2-oxopyrrolidin-1-yl)pentanoate |
| SMILES | CCC(C)(CC(C)N1CCCC1=O)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H37NO3/c1-5-22(3,14-15(2)24-8-6-7-20(24)25)21(26)27-23(4)18-10-16-9-17(12-18)13-19(23)11-16/h15-19H,5-14H2,1-4H3 |
| InChIKey | ARDQJPVWWLXQDK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |