C30H54N2O8S2 — CID 123754573
sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,6-dimethylpiperidine-1-carboxylate;sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,2,6,6-tetramethylpiperidine-1-carboxylate (PubChem CID 123754573) has the molecular formula C30H54N2O8S2 and a molecular weight of 634.90 g/mol. Its IUPAC name is sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,6-dimethylpiperidine-1-carboxylate;sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,2,6,6-tetramethylpiperidine-1-carboxylate.
| Compound Name | sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,6-dimethylpiperidine-1-carboxylate;sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,2,6,6-tetramethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123754573 |
| Molecular Formula | C30H54N2O8S2 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,6-dimethylpiperidine-1-carboxylate;sulfanyl 4-(2,2-dimethylbutanoyloxy)-2,2,6,6-tetramethylpiperidine-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)(C)N(C(=O)OS)C(C)(C)C1.CCC(C)(C)C(=O)OC1CC(C)N(C(=O)OS)C(C)C1 |
| InChI | InChI=1S/C16H29NO4S.C14H25NO4S/c1-8-14(2,3)12(18)20-11-9-15(4,5)17(13(19)21-22)16(6,7)10-11;1-6-14(4,5)12(16)18-11-7-9(2)15(10(3)8-11)13(17)19-20/h11,22H,8-10H2,1-7H3;9-11,20H,6-8H2,1-5H3 |
| InChIKey | IFYIBFKCIKJABU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|