C21H31NO3 — CID 130458101
(5R)-5-[(6R)-6-(3-ethoxypropyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-oxazocan-2-one (PubChem CID 130458101) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (5R)-5-[(6R)-6-(3-ethoxypropyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-oxazocan-2-one.
| Compound Name | (5R)-5-[(6R)-6-(3-ethoxypropyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-oxazocan-2-one |
|---|---|
| PubChem CID | 130458101 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (5R)-5-[(6R)-6-(3-ethoxypropyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-oxazocan-2-one |
| SMILES | CCOCCC[C@H]1CCc2cc([C@H]3CCCOC(=O)NC3)ccc2C1 |
| InChI | InChI=1S/C21H31NO3/c1-2-24-11-3-5-16-7-8-18-14-19(10-9-17(18)13-16)20-6-4-12-25-21(23)22-15-20/h9-10,14,16,20H,2-8,11-13,15H2,1H3,(H,22,23)/t16-,20-/m0/s1 |
| InChIKey | SJLIQLWIGGXAHY-JXFKEZNVSA-N |
| XLogP | 4.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|