C22H31NO3 — CID 126581802
(5R,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one (PubChem CID 126581802) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (5R,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one.
| Compound Name | (5R,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 126581802 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (5R,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one |
| SMILES | CCCCOCC1CCc2cc([C@H]3CC[C@]4(COC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C22H31NO3/c1-2-3-10-25-14-16-4-5-18-12-19(7-6-17(18)11-16)20-8-9-22(13-20)15-26-21(24)23-22/h6-7,12,16,20H,2-5,8-11,13-15H2,1H3,(H,23,24)/t16?,20-,22+/m0/s1 |
| InChIKey | QGSZRULTKLWYDE-CLVUSQIQSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|