C23H32O3 — CID 147116702
(5S,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-2-oxaspiro[4.4]nonan-3-one (PubChem CID 147116702) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (5S,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-2-oxaspiro[4.4]nonan-3-one.
| Compound Name | (5S,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-2-oxaspiro[4.4]nonan-3-one |
|---|---|
| PubChem CID | 147116702 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (5S,8S)-8-[6-(butoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-2-oxaspiro[4.4]nonan-3-one |
| SMILES | CCCCOCC1CCc2cc([C@H]3CC[C@]4(COC(=O)C4)C3)ccc2C1 |
| InChI | InChI=1S/C23H32O3/c1-2-3-10-25-15-17-4-5-19-12-20(7-6-18(19)11-17)21-8-9-23(13-21)14-22(24)26-16-23/h6-7,12,17,21H,2-5,8-11,13-16H2,1H3/t17?,21-,23-/m0/s1 |
| InChIKey | BNOGNRLKBPYTPR-ZONZVIQZSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|