C23H31NO2 — CID 118900016
4-[(2R)-6-[(3S,5R)-7-oxo-6-azaspiro[4.5]decan-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]butanal (PubChem CID 118900016) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[(2R)-6-[(3S,5R)-7-oxo-6-azaspiro[4.5]decan-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]butanal.
| Compound Name | 4-[(2R)-6-[(3S,5R)-7-oxo-6-azaspiro[4.5]decan-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]butanal |
|---|---|
| PubChem CID | 118900016 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-[(2R)-6-[(3S,5R)-7-oxo-6-azaspiro[4.5]decan-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]butanal |
| SMILES | O=CCCC[C@@H]1CCc2cc([C@H]3CC[C@]4(CCCC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C23H31NO2/c25-13-2-1-4-17-6-7-19-15-20(9-8-18(19)14-17)21-10-12-23(16-21)11-3-5-22(26)24-23/h8-9,13,15,17,21H,1-7,10-12,14,16H2,(H,24,26)/t17-,21+,23-/m1/s1 |
| InChIKey | ZFEPOJTZAVXEAR-FRGLQRNOSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|