C9H11ClO2S — CID 13046
2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 13046) has the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. Its IUPAC name is 2,4,6-trimethylbenzenesulfonyl chloride.
| Compound Name | 2,4,6-trimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 13046 |
| Molecular Formula | C9H11ClO2S |
| Molecular Weight | 218.70 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2,4,6-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1 |
| InChI | InChI=1S/C9H11ClO2S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5H,1-3H3 |
| InChIKey | PVJZBZSCGJAWNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |