C21H20F9P — CID 130460276
[2,5-bis(trifluoromethyl)phenyl]-[2-hexan-2-yl-5-(trifluoromethyl)phenyl]phosphane (PubChem CID 130460276) has the molecular formula C21H20F9P and a molecular weight of 474.35 g/mol. Its IUPAC name is [2,5-bis(trifluoromethyl)phenyl]-[2-hexan-2-yl-5-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [2,5-bis(trifluoromethyl)phenyl]-[2-hexan-2-yl-5-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 130460276 |
| Molecular Formula | C21H20F9P |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [2,5-bis(trifluoromethyl)phenyl]-[2-hexan-2-yl-5-(trifluoromethyl)phenyl]phosphane |
| SMILES | CCCCC(C)c1ccc(C(F)(F)F)cc1Pc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C21H20F9P/c1-3-4-5-12(2)15-8-6-13(19(22,23)24)10-17(15)31-18-11-14(20(25,26)27)7-9-16(18)21(28,29)30/h6-12,31H,3-5H2,1-2H3 |
| InChIKey | SKIDSMSDIGQPCD-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|