S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate

C13H16Cl2OS — CID 130460399

IUPACS-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate
SMILESCC(C)CCCSC(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H16Cl2OS/c1-9(2)4-3-7-17-13(16)11-6-5-10(14)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3
InChIKeyPAUKAZIYIHYDLO-UHFFFAOYSA-N
MW291.24 g/mol
LogP5.30
Rot. Bonds5

About S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate

S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate (PubChem CID 130460399) has the molecular formula C13H16Cl2OS and a molecular weight of 291.24 g/mol. Its IUPAC name is S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate.

Molecular Properties

Compound NameS-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate
PubChem CID130460399
Molecular FormulaC13H16Cl2OS
Molecular Weight291.24 g/mol
Exact Mass290.03
IUPAC NameS-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate
SMILESCC(C)CCCSC(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H16Cl2OS/c1-9(2)4-3-7-17-13(16)11-6-5-10(14)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3
InChIKeyPAUKAZIYIHYDLO-UHFFFAOYSA-N
XLogP5.30
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500291.24
LogP ≤ 55.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate?
The IUPAC name of S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate (CID 130460399) is S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate.
What is the SMILES notation for S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate?
The canonical SMILES for S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate is CC(C)CCCSC(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate?
The InChIKey is PAUKAZIYIHYDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2OS/c1-9(2)4-3-7-17-13(16)11-6-5-10(14)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate?
S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate has a molecular weight of 291.24 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate is sourced from PubChem (CID 130460399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).