C13H16Cl2OS — CID 130460399
S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate (PubChem CID 130460399) has the molecular formula C13H16Cl2OS and a molecular weight of 291.24 g/mol. Its IUPAC name is S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate.
| Compound Name | S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate |
|---|---|
| PubChem CID | 130460399 |
| Molecular Formula | C13H16Cl2OS |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | S-(4-methylpentyl) 2,4-dichlorobenzenecarbothioate |
| SMILES | CC(C)CCCSC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2OS/c1-9(2)4-3-7-17-13(16)11-6-5-10(14)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | PAUKAZIYIHYDLO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|