C9H12O7S — CID 130460471
(3E)-2-methyl-3-[(E)-3-sulfobut-2-enylidene]butanedioic acid (PubChem CID 130460471) has the molecular formula C9H12O7S and a molecular weight of 264.25 g/mol. Its IUPAC name is (3E)-2-methyl-3-[(E)-3-sulfobut-2-enylidene]butanedioic acid.
| Compound Name | (3E)-2-methyl-3-[(E)-3-sulfobut-2-enylidene]butanedioic acid |
|---|---|
| PubChem CID | 130460471 |
| Molecular Formula | C9H12O7S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (3E)-2-methyl-3-[(E)-3-sulfobut-2-enylidene]butanedioic acid |
| SMILES | C/C(=C\C=C(\C(=O)O)C(C)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C9H12O7S/c1-5(17(14,15)16)3-4-7(9(12)13)6(2)8(10)11/h3-4,6H,1-2H3,(H,10,11)(H,12,13)(H,14,15,16)/b5-3+,7-4+ |
| InChIKey | FUDUMJQFXQBDCE-HJIKTHEYSA-N |
| XLogP | 0.51 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|