About barium(2+);2-sulfopropanoic acid
barium(2+);2-sulfopropanoic acid (PubChem CID 54607271) has the molecular formula C3H6BaO5S+2
and a molecular weight of 291.47 g/mol. Its IUPAC name is barium(2+);2-sulfopropanoic acid.
Molecular Properties
| Compound Name | barium(2+);2-sulfopropanoic acid |
| PubChem CID | 54607271 |
| Molecular Formula | C3H6BaO5S+2 |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.90 |
| IUPAC Name | barium(2+);2-sulfopropanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)O.[Ba+2] |
| InChI | InChI=1S/C3H6O5S.Ba/c1-2(3(4)5)9(6,7)8;/h2H,1H3,(H,4,5)(H,6,7,8);/q;+2 |
| InChIKey | TZWLABKSRPBWJU-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);2-sulfopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-sulfopropanoic acid?
The IUPAC name of barium(2+);2-sulfopropanoic acid (CID 54607271) is barium(2+);2-sulfopropanoic acid.
What is the SMILES notation for barium(2+);2-sulfopropanoic acid?
The canonical SMILES for barium(2+);2-sulfopropanoic acid is CC(C(=O)O)S(=O)(=O)O.[Ba+2].
What is the InChIKey of barium(2+);2-sulfopropanoic acid?
The InChIKey is TZWLABKSRPBWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O5S.Ba/c1-2(3(4)5)9(6,7)8;/h2H,1H3,(H,4,5)(H,6,7,8);/q;+2.
What are the key properties of barium(2+);2-sulfopropanoic acid?
barium(2+);2-sulfopropanoic acid has a molecular weight of 291.47 g/mol, XLogP of -1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-sulfopropanoic acid is sourced from PubChem (CID 54607271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).