C21H24N2O6S2 — CID 130460936
N-cyclopropyl-4-[[1-(furan-2-carbonyl)-2,3,6,7-tetrahydroazepin-4-yl]methylsulfonyl]benzenesulfonamide (PubChem CID 130460936) has the molecular formula C21H24N2O6S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-cyclopropyl-4-[[1-(furan-2-carbonyl)-2,3,6,7-tetrahydroazepin-4-yl]methylsulfonyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[[1-(furan-2-carbonyl)-2,3,6,7-tetrahydroazepin-4-yl]methylsulfonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 130460936 |
| Molecular Formula | C21H24N2O6S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-cyclopropyl-4-[[1-(furan-2-carbonyl)-2,3,6,7-tetrahydroazepin-4-yl]methylsulfonyl]benzenesulfonamide |
| SMILES | O=C(c1ccco1)N1CCC=C(CS(=O)(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O6S2/c24-21(20-4-2-14-29-20)23-12-1-3-16(11-13-23)15-30(25,26)18-7-9-19(10-8-18)31(27,28)22-17-5-6-17/h2-4,7-10,14,17,22H,1,5-6,11-13,15H2 |
| InChIKey | QRKJOCVEFGCPTI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|