C29H32ClN9O3S — CID 130461374
3,5-diamino-6-chloro-N-[8-[4-[(2-cyclohexa-1,5-dien-1-yl-5-methyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfanyl-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide (PubChem CID 130461374) has the molecular formula C29H32ClN9O3S and a molecular weight of 622.16 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[8-[4-[(2-cyclohexa-1,5-dien-1-yl-5-methyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfanyl-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[8-[4-[(2-cyclohexa-1,5-dien-1-yl-5-methyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfanyl-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130461374 |
| Molecular Formula | C29H32ClN9O3S |
| Molecular Weight | 622.16 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[8-[4-[(2-cyclohexa-1,5-dien-1-yl-5-methyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfanyl-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
| SMILES | Cc1oc(C2=CCCC=C2)nc1COc1ccc(SN2CCC3(CC2)CN=C(NC(=O)c2nc(Cl)c(N)nc2N)N3)cc1 |
| InChI | InChI=1S/C29H32ClN9O3S/c1-17-21(34-27(42-17)18-5-3-2-4-6-18)15-41-19-7-9-20(10-8-19)43-39-13-11-29(12-14-39)16-33-28(38-29)37-26(40)22-24(31)36-25(32)23(30)35-22/h3,5-10H,2,4,11-16H2,1H3,(H4,31,32,36)(H2,33,37,38,40) |
| InChIKey | QSTLBUKFPOMAMV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|