C29H35ClFN9O3 — CID 130461500
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-N-[2-[4-[2-(4-fluorocyclohexa-1,3-dien-1-yl)ethoxy]phenyl]ethyl]-1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxamide (PubChem CID 130461500) has the molecular formula C29H35ClFN9O3 and a molecular weight of 612.11 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-N-[2-[4-[2-(4-fluorocyclohexa-1,3-dien-1-yl)ethoxy]phenyl]ethyl]-1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxamide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-N-[2-[4-[2-(4-fluorocyclohexa-1,3-dien-1-yl)ethoxy]phenyl]ethyl]-1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 130461500 |
| Molecular Formula | C29H35ClFN9O3 |
| Molecular Weight | 612.11 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-N-[2-[4-[2-(4-fluorocyclohexa-1,3-dien-1-yl)ethoxy]phenyl]ethyl]-1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)NC2=NCC3(CCN(C(=O)NCCc4ccc(OCCC5=CC=C(F)CC5)cc4)CC3)N2)nc1Cl |
| InChI | InChI=1S/C29H35ClFN9O3/c30-23-25(33)37-24(32)22(36-23)26(41)38-27-35-17-29(39-27)11-14-40(15-12-29)28(42)34-13-9-18-3-7-21(8-4-18)43-16-10-19-1-5-20(31)6-2-19/h1,3-5,7-8H,2,6,9-17H2,(H,34,42)(H4,32,33,37)(H2,35,38,39,41) |
| InChIKey | NIYYTBIENUGYIX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |