C25H33ClN8O5 — CID 58447435
3,5-diamino-6-chloro-N-[8-[3-[4-(2-methoxyethoxymethoxy)phenyl]propanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide (PubChem CID 58447435) has the molecular formula C25H33ClN8O5 and a molecular weight of 561.04 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[8-[3-[4-(2-methoxyethoxymethoxy)phenyl]propanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[8-[3-[4-(2-methoxyethoxymethoxy)phenyl]propanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58447435 |
| Molecular Formula | C25H33ClN8O5 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[8-[3-[4-(2-methoxyethoxymethoxy)phenyl]propanoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]pyrazine-2-carboxamide |
| SMILES | COCCOCOc1ccc(CCC(=O)N2CCC3(CC2)CN=C(NC(=O)c2nc(Cl)c(N)nc2N)N3)cc1 |
| InChI | InChI=1S/C25H33ClN8O5/c1-37-12-13-38-15-39-17-5-2-16(3-6-17)4-7-18(35)34-10-8-25(9-11-34)14-29-24(33-25)32-23(36)19-21(27)31-22(28)20(26)30-19/h2-3,5-6H,4,7-15H2,1H3,(H4,27,28,31)(H2,29,32,33,36) |
| InChIKey | YOOLPXJSPCPENF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 179.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|