C32H57N3O2 — CID 130461626
(2R,5S,7R,8R,14R)-8-[2-(1H-imidazol-5-yl)ethylamino]-2,11-dimethyl-14-(6-methylheptan-2-yl)tricyclo[8.7.0.02,7]heptadecane-5,7-diol (PubChem CID 130461626) has the molecular formula C32H57N3O2 and a molecular weight of 515.83 g/mol. Its IUPAC name is (2R,5S,7R,8R,14R)-8-[2-(1H-imidazol-5-yl)ethylamino]-2,11-dimethyl-14-(6-methylheptan-2-yl)tricyclo[8.7.0.02,7]heptadecane-5,7-diol.
| Compound Name | (2R,5S,7R,8R,14R)-8-[2-(1H-imidazol-5-yl)ethylamino]-2,11-dimethyl-14-(6-methylheptan-2-yl)tricyclo[8.7.0.02,7]heptadecane-5,7-diol |
|---|---|
| PubChem CID | 130461626 |
| Molecular Formula | C32H57N3O2 |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 515.45 |
| IUPAC Name | (2R,5S,7R,8R,14R)-8-[2-(1H-imidazol-5-yl)ethylamino]-2,11-dimethyl-14-(6-methylheptan-2-yl)tricyclo[8.7.0.02,7]heptadecane-5,7-diol |
| SMILES | CC(C)CCCC(C)[C@@H]1CCCC2C(C[C@@H](NCCc3cnc[nH]3)[C@@]3(O)C[C@@H](O)CC[C@]23C)C(C)CC1 |
| InChI | InChI=1S/C32H57N3O2/c1-22(2)8-6-9-23(3)25-10-7-11-29-28(24(4)12-13-25)18-30(34-17-15-26-20-33-21-35-26)32(37)19-27(36)14-16-31(29,32)5/h20-25,27-30,34,36-37H,6-19H2,1-5H3,(H,33,35)/t23?,24?,25-,27+,28?,29?,30-,31-,32+/m1/s1 |
| InChIKey | ZYRQCXJMOIPKKJ-RTOGWDSASA-N |
| XLogP | 6.51 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |