C28H50 — CID 165392357
(1S,2R,5S,10S,11S,14R)-2,5,11-trimethyl-14-[(2R)-6-methylheptan-2-yl]tricyclo[8.7.0.02,7]heptadec-7-ene (PubChem CID 165392357) has the molecular formula C28H50 and a molecular weight of 386.71 g/mol. Its IUPAC name is (1S,2R,5S,10S,11S,14R)-2,5,11-trimethyl-14-[(2R)-6-methylheptan-2-yl]tricyclo[8.7.0.02,7]heptadec-7-ene.
| Compound Name | (1S,2R,5S,10S,11S,14R)-2,5,11-trimethyl-14-[(2R)-6-methylheptan-2-yl]tricyclo[8.7.0.02,7]heptadec-7-ene |
|---|---|
| PubChem CID | 165392357 |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | (1S,2R,5S,10S,11S,14R)-2,5,11-trimethyl-14-[(2R)-6-methylheptan-2-yl]tricyclo[8.7.0.02,7]heptadec-7-ene |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CCC[C@H]2[C@@H](CC=C3C[C@@H](C)CC[C@@]32C)[C@@H](C)CC1 |
| InChI | InChI=1S/C28H50/c1-20(2)9-7-10-22(4)24-11-8-12-27-26(23(5)13-14-24)16-15-25-19-21(3)17-18-28(25,27)6/h15,20-24,26-27H,7-14,16-19H2,1-6H3/t21-,22+,23-,24+,26-,27-,28-/m0/s1 |
| InChIKey | ZSXDEFZMVNROPY-WMFPUDPCSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|