C41H73NO8 — CID 143714500
[(2R)-2,11-dimethyl-14-(6-methylheptan-2-yl)-5-tricyclo[8.7.0.02,7]heptadec-7-enyl] N-[6-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxyhexyl]carbamate (PubChem CID 143714500) has the molecular formula C41H73NO8 and a molecular weight of 708.03 g/mol. Its IUPAC name is [(2R)-2,11-dimethyl-14-(6-methylheptan-2-yl)-5-tricyclo[8.7.0.02,7]heptadec-7-enyl] N-[6-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxyhexyl]carbamate.
| Compound Name | [(2R)-2,11-dimethyl-14-(6-methylheptan-2-yl)-5-tricyclo[8.7.0.02,7]heptadec-7-enyl] N-[6-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxyhexyl]carbamate |
|---|---|
| PubChem CID | 143714500 |
| Molecular Formula | C41H73NO8 |
| Molecular Weight | 708.03 g/mol |
| Exact Mass | 707.53 |
| IUPAC Name | [(2R)-2,11-dimethyl-14-(6-methylheptan-2-yl)-5-tricyclo[8.7.0.02,7]heptadec-7-enyl] N-[6-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxyhexyl]carbamate |
| SMILES | CC(C)CCCC(C)C1CCCC2C(CC=C3CC(OC(=O)NCCCCCCOC4OC(C)(CO)[C@@H](O)C(O)C4O)CC[C@@]32C)C(C)CC1 |
| InChI | InChI=1S/C41H73NO8/c1-27(2)13-11-14-28(3)30-15-12-16-34-33(29(4)17-18-30)20-19-31-25-32(21-22-40(31,34)5)49-39(47)42-23-9-7-8-10-24-48-38-36(45)35(44)37(46)41(6,26-43)50-38/h19,27-30,32-38,43-46H,7-18,20-26H2,1-6H3,(H,42,47)/t28?,29?,30?,32?,33?,34?,35?,36?,37-,38?,40-,41?/m0/s1 |
| InChIKey | RLFRTEKUZABWQU-STWZUPOVSA-N |
| XLogP | 7.28 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.03 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|