C26H43F3O2 — CID 123145807
2,5,11-trimethyl-14-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol (PubChem CID 123145807) has the molecular formula C26H43F3O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2,5,11-trimethyl-14-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol.
| Compound Name | 2,5,11-trimethyl-14-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol |
|---|---|
| PubChem CID | 123145807 |
| Molecular Formula | C26H43F3O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 2,5,11-trimethyl-14-(6,6,6-trifluoro-5-hydroxyhexan-2-yl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol |
| SMILES | CC(CCC(O)C(F)(F)F)C1CCCC2C(CC=C3CC(C)(O)CCC32C)C(C)CC1 |
| InChI | InChI=1S/C26H43F3O2/c1-17(9-13-23(30)26(27,28)29)19-6-5-7-22-21(18(2)8-10-19)12-11-20-16-24(3,31)14-15-25(20,22)4/h11,17-19,21-23,30-31H,5-10,12-16H2,1-4H3 |
| InChIKey | DDGCYCAHZYADRO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|