C24H36F6O2 — CID 167251344
(1S,2R,5S,10S,11S,14R)-2,11-dimethyl-14-[(2S,3R)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-5-(trifluoromethyl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol (PubChem CID 167251344) has the molecular formula C24H36F6O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is (1S,2R,5S,10S,11S,14R)-2,11-dimethyl-14-[(2S,3R)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-5-(trifluoromethyl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol.
| Compound Name | (1S,2R,5S,10S,11S,14R)-2,11-dimethyl-14-[(2S,3R)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-5-(trifluoromethyl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol |
|---|---|
| PubChem CID | 167251344 |
| Molecular Formula | C24H36F6O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (1S,2R,5S,10S,11S,14R)-2,11-dimethyl-14-[(2S,3R)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-5-(trifluoromethyl)tricyclo[8.7.0.02,7]heptadec-7-en-5-ol |
| SMILES | C[C@@H]([C@@H]1CCC[C@H]2[C@@H](CC=C3C[C@](O)(C(F)(F)F)CC[C@@]32C)[C@@H](C)CC1)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C24H36F6O2/c1-14-7-8-16(15(2)20(31)23(25,26)27)5-4-6-19-18(14)10-9-17-13-22(32,24(28,29)30)12-11-21(17,19)3/h9,14-16,18-20,31-32H,4-8,10-13H2,1-3H3/t14-,15-,16+,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | KEDJJCGLKKWRGT-ASCJQENTSA-N |
| XLogP | 6.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|