C24H30N2O4 — CID 130462267
3-[[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)anilino]-hydroxymethyl]-1H-quinolin-4-one (PubChem CID 130462267) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-[[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)anilino]-hydroxymethyl]-1H-quinolin-4-one.
| Compound Name | 3-[[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)anilino]-hydroxymethyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 130462267 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-[[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)anilino]-hydroxymethyl]-1H-quinolin-4-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)CO)c(O)cc1NC(O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C24H30N2O4/c1-23(2,3)16-10-17(24(4,5)13-27)20(28)11-19(16)26-22(30)15-12-25-18-9-7-6-8-14(18)21(15)29/h6-12,22,26-28,30H,13H2,1-5H3,(H,25,29) |
| InChIKey | QZNZFFYULQYGBT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|