C26H34N2O3 — CID 123201345
3-[[2,4-ditert-butyl-5-(methoxymethoxy)anilino]methyl]-1H-quinolin-4-one (PubChem CID 123201345) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[[2,4-ditert-butyl-5-(methoxymethoxy)anilino]methyl]-1H-quinolin-4-one.
| Compound Name | 3-[[2,4-ditert-butyl-5-(methoxymethoxy)anilino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 123201345 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 3-[[2,4-ditert-butyl-5-(methoxymethoxy)anilino]methyl]-1H-quinolin-4-one |
| SMILES | COCOc1cc(NCc2c[nH]c3ccccc3c2=O)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H34N2O3/c1-25(2,3)19-12-20(26(4,5)6)23(31-16-30-7)13-22(19)28-15-17-14-27-21-11-9-8-10-18(21)24(17)29/h8-14,28H,15-16H2,1-7H3,(H,27,29) |
| InChIKey | ILLPOVYCZSEIEW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|