C23H32N6O — CID 130463688
6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methyl-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine (PubChem CID 130463688) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methyl-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine.
| Compound Name | 6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methyl-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 130463688 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methyl-N-(4-morpholin-4-ylcyclohexyl)quinazolin-4-amine |
| SMILES | C/N=C/C(=C\N)c1ccc2ncnc(NC3CCC(N4CCOCC4)CC3)c2c1C |
| InChI | InChI=1S/C23H32N6O/c1-16-20(17(13-24)14-25-2)7-8-21-22(16)23(27-15-26-21)28-18-3-5-19(6-4-18)29-9-11-30-12-10-29/h7-8,13-15,18-19H,3-6,9-12,24H2,1-2H3,(H,26,27,28)/b17-13+,25-14+ |
| InChIKey | GAUKPDYBCLPIKZ-DONFXTHASA-N |
| XLogP | 2.99 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|