C24H34N6O2 — CID 146739493
2-amino-4-methylimino-3-[4-[(4-morpholin-4-ylcyclohexyl)methylamino]quinazolin-6-yl]but-2-en-1-ol (PubChem CID 146739493) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-amino-4-methylimino-3-[4-[(4-morpholin-4-ylcyclohexyl)methylamino]quinazolin-6-yl]but-2-en-1-ol.
| Compound Name | 2-amino-4-methylimino-3-[4-[(4-morpholin-4-ylcyclohexyl)methylamino]quinazolin-6-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 146739493 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 2-amino-4-methylimino-3-[4-[(4-morpholin-4-ylcyclohexyl)methylamino]quinazolin-6-yl]but-2-en-1-ol |
| SMILES | C/N=C/C(=C(N)CO)c1ccc2ncnc(NCC3CCC(N4CCOCC4)CC3)c2c1 |
| InChI | InChI=1S/C24H34N6O2/c1-26-14-21(22(25)15-31)18-4-7-23-20(12-18)24(29-16-28-23)27-13-17-2-5-19(6-3-17)30-8-10-32-11-9-30/h4,7,12,14,16-17,19,31H,2-3,5-6,8-11,13,15,25H2,1H3,(H,27,28,29)/b22-21?,26-14+ |
| InChIKey | TZMKDTLHUOVQEF-XIHRRMGZSA-N |
| XLogP | 2.30 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|