C21H31N5O — CID 146237700
4-N-[[4-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]quinazoline-4,6-diamine (PubChem CID 146237700) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-N-[[4-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[[4-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 146237700 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-N-[[4-(2,2-dimethylmorpholin-4-yl)cyclohexyl]methyl]quinazoline-4,6-diamine |
| SMILES | CC1(C)CN(C2CCC(CNc3ncnc4ccc(N)cc34)CC2)CCO1 |
| InChI | InChI=1S/C21H31N5O/c1-21(2)13-26(9-10-27-21)17-6-3-15(4-7-17)12-23-20-18-11-16(22)5-8-19(18)24-14-25-20/h5,8,11,14-15,17H,3-4,6-7,9-10,12-13,22H2,1-2H3,(H,23,24,25) |
| InChIKey | SDBDVSUVXHZIEG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|