C41H30N2O — CID 130465590
4-[4-(9,9-dimethylfluoren-1-yl)phenyl]-2-(furan-2-yl)-6-(4-phenylphenyl)pyrimidine (PubChem CID 130465590) has the molecular formula C41H30N2O and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-[4-(9,9-dimethylfluoren-1-yl)phenyl]-2-(furan-2-yl)-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[4-(9,9-dimethylfluoren-1-yl)phenyl]-2-(furan-2-yl)-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 130465590 |
| Molecular Formula | C41H30N2O |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 4-[4-(9,9-dimethylfluoren-1-yl)phenyl]-2-(furan-2-yl)-6-(4-phenylphenyl)pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3ccc(-c4cc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccco5)n4)cc3)c21 |
| InChI | InChI=1S/C41H30N2O/c1-41(2)35-15-7-6-12-33(35)34-14-8-13-32(39(34)41)29-19-23-31(24-20-29)37-26-36(42-40(43-37)38-16-9-25-44-38)30-21-17-28(18-22-30)27-10-4-3-5-11-27/h3-26H,1-2H3 |
| InChIKey | ACSDCUHGGRFSIN-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |