C26H29NO4 — CID 130466575
tert-butyl 2-[[4-[2-methoxy-5-(3-methylphenyl)phenyl]-2-pyridinyl]methoxy]acetate (PubChem CID 130466575) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl 2-[[4-[2-methoxy-5-(3-methylphenyl)phenyl]-2-pyridinyl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[4-[2-methoxy-5-(3-methylphenyl)phenyl]-2-pyridinyl]methoxy]acetate |
|---|---|
| PubChem CID | 130466575 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | tert-butyl 2-[[4-[2-methoxy-5-(3-methylphenyl)phenyl]-2-pyridinyl]methoxy]acetate |
| SMILES | COc1ccc(-c2cccc(C)c2)cc1-c1ccnc(COCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H29NO4/c1-18-7-6-8-19(13-18)20-9-10-24(29-5)23(15-20)21-11-12-27-22(14-21)16-30-17-25(28)31-26(2,3)4/h6-15H,16-17H2,1-5H3 |
| InChIKey | WQFGBSKUQZHFBK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |