C25H24F3NO3 — CID 159460523
tert-butyl 3-[4-[2-hydroxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]propanoate (PubChem CID 159460523) has the molecular formula C25H24F3NO3 and a molecular weight of 443.47 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-hydroxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]propanoate.
| Compound Name | tert-butyl 3-[4-[2-hydroxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 159460523 |
| Molecular Formula | C25H24F3NO3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | tert-butyl 3-[4-[2-hydroxy-5-[3-(trifluoromethyl)phenyl]phenyl]-2-pyridinyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc(-c2cc(-c3cccc(C(F)(F)F)c3)ccc2O)ccn1 |
| InChI | InChI=1S/C25H24F3NO3/c1-24(2,3)32-23(31)10-8-20-14-18(11-12-29-20)21-15-17(7-9-22(21)30)16-5-4-6-19(13-16)25(26,27)28/h4-7,9,11-15,30H,8,10H2,1-3H3 |
| InChIKey | LUNOOUDQDPECLU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |