C22H26ClN7O3 — CID 130467144
4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methyl-N-(morpholin-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 130467144) has the molecular formula C22H26ClN7O3 and a molecular weight of 471.95 g/mol. Its IUPAC name is 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methyl-N-(morpholin-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methyl-N-(morpholin-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130467144 |
| Molecular Formula | C22H26ClN7O3 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methyl-N-(morpholin-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cccc(-c3cnn(CCCl)c3)c2)c(C(=O)NCC2CNCCO2)n1 |
| InChI | InChI=1S/C22H26ClN7O3/c1-29-14-19(20(28-29)22(32)25-12-18-11-24-6-8-33-18)27-21(31)16-4-2-3-15(9-16)17-10-26-30(13-17)7-5-23/h2-4,9-10,13-14,18,24H,5-8,11-12H2,1H3,(H,25,32)(H,27,31) |
| InChIKey | OQVMDVCCDBNOHD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|