C25H22N6O3 — CID 122470003
17-methyl-6,14,17,18,21,30-hexazapentacyclo[22.3.1.12,6.18,12.015,19]triaconta-1(27),2(30),3,8(29),9,11,15,18,24(28),25-decaene-5,13,20-trione (PubChem CID 122470003) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 17-methyl-6,14,17,18,21,30-hexazapentacyclo[22.3.1.12,6.18,12.015,19]triaconta-1(27),2(30),3,8(29),9,11,15,18,24(28),25-decaene-5,13,20-trione.
| Compound Name | 17-methyl-6,14,17,18,21,30-hexazapentacyclo[22.3.1.12,6.18,12.015,19]triaconta-1(27),2(30),3,8(29),9,11,15,18,24(28),25-decaene-5,13,20-trione |
|---|---|
| PubChem CID | 122470003 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 17-methyl-6,14,17,18,21,30-hexazapentacyclo[22.3.1.12,6.18,12.015,19]triaconta-1(27),2(30),3,8(29),9,11,15,18,24(28),25-decaene-5,13,20-trione |
| SMILES | Cn1cc2c(n1)C(=O)NCCc1cccc(c1)-c1ccc(=O)n(n1)Cc1cccc(c1)C(=O)N2 |
| InChI | InChI=1S/C25H22N6O3/c1-30-15-21-23(29-30)25(34)26-11-10-16-4-2-6-18(12-16)20-8-9-22(32)31(28-20)14-17-5-3-7-19(13-17)24(33)27-21/h2-9,12-13,15H,10-11,14H2,1H3,(H,26,34)(H,27,33) |
| InChIKey | ZZPZTQIZEUBASL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |