C21H23N7O3 — CID 130473835
17-methyl-10-oxa-4,5,7,13,16,17,20-heptazapentacyclo[20.3.1.12,5.17,11.015,19]octacosa-1(26),2(28),3,15,18,22,24-heptaene-14,21-dione (PubChem CID 130473835) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 17-methyl-10-oxa-4,5,7,13,16,17,20-heptazapentacyclo[20.3.1.12,5.17,11.015,19]octacosa-1(26),2(28),3,15,18,22,24-heptaene-14,21-dione.
| Compound Name | 17-methyl-10-oxa-4,5,7,13,16,17,20-heptazapentacyclo[20.3.1.12,5.17,11.015,19]octacosa-1(26),2(28),3,15,18,22,24-heptaene-14,21-dione |
|---|---|
| PubChem CID | 130473835 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 17-methyl-10-oxa-4,5,7,13,16,17,20-heptazapentacyclo[20.3.1.12,5.17,11.015,19]octacosa-1(26),2(28),3,15,18,22,24-heptaene-14,21-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCC1CN(CCO1)Cn1cc(cn1)-c1cccc(c1)C(=O)N2 |
| InChI | InChI=1S/C21H23N7O3/c1-26-12-18-19(25-26)21(30)22-9-17-11-27(5-6-31-17)13-28-10-16(8-23-28)14-3-2-4-15(7-14)20(29)24-18/h2-4,7-8,10,12,17H,5-6,9,11,13H2,1H3,(H,22,30)(H,24,29) |
| InChIKey | OLAMDDXOQHLPJQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |