C22H28N6O3 — CID 145134389
(18E)-12-(aminomethyl)-19-ethenyl-6-methyl-13-oxa-3,6,7,10,24-pentazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,18,20(24),21-hexaene-2,9-dione (PubChem CID 145134389) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is (18E)-12-(aminomethyl)-19-ethenyl-6-methyl-13-oxa-3,6,7,10,24-pentazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,18,20(24),21-hexaene-2,9-dione.
| Compound Name | (18E)-12-(aminomethyl)-19-ethenyl-6-methyl-13-oxa-3,6,7,10,24-pentazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,18,20(24),21-hexaene-2,9-dione |
|---|---|
| PubChem CID | 145134389 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (18E)-12-(aminomethyl)-19-ethenyl-6-methyl-13-oxa-3,6,7,10,24-pentazatricyclo[18.3.1.04,8]tetracosa-1(23),4,7,18,20(24),21-hexaene-2,9-dione |
| SMILES | C=C/C1=C\CCCCOC(CN)CNC(=O)c2nn(C)cc2NC(=O)c2cccc1n2 |
| InChI | InChI=1S/C22H28N6O3/c1-3-15-8-5-4-6-11-31-16(12-23)13-24-22(30)20-19(14-28(2)27-20)26-21(29)18-10-7-9-17(15)25-18/h3,7-10,14,16H,1,4-6,11-13,23H2,2H3,(H,24,30)(H,26,29)/b15-8+ |
| InChIKey | AWLNAJAIBRSQFR-OVCLIPMQSA-N |
| XLogP | 1.89 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |