C21H22N6O3 — CID 160587522
11-methyl-18-oxa-4,8,11,12,21,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,9,12,22,24-octaene-7,14-dione (PubChem CID 160587522) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 11-methyl-18-oxa-4,8,11,12,21,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,9,12,22,24-octaene-7,14-dione.
| Compound Name | 11-methyl-18-oxa-4,8,11,12,21,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,9,12,22,24-octaene-7,14-dione |
|---|---|
| PubChem CID | 160587522 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 11-methyl-18-oxa-4,8,11,12,21,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,9,12,22,24-octaene-7,14-dione |
| SMILES | Cn1cc2c(n1)C(=O)CCCOCCNc1cc(ccn1)-c1cncc(c1)C(=O)N2 |
| InChI | InChI=1S/C21H22N6O3/c1-27-13-17-20(26-27)18(28)3-2-7-30-8-6-24-19-10-14(4-5-23-19)15-9-16(12-22-11-15)21(29)25-17/h4-5,9-13H,2-3,6-8H2,1H3,(H,23,24)(H,25,29) |
| InChIKey | LNFJUTJGQAPNGH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |