C30H36N6O5S — CID 153076252
17-(oxane-4-carbonyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 153076252) has the molecular formula C30H36N6O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is 17-(oxane-4-carbonyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 17-(oxane-4-carbonyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 153076252 |
| Molecular Formula | C30H36N6O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 17-(oxane-4-carbonyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)CCCN(C(=O)C2CCOCC2)CCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C30H36N6O5S/c37-26-4-2-12-35(30(39)20-6-13-40-14-7-20)11-1-3-22-17-21(5-10-31-22)29-33-25(19-42-29)28(38)32-24-18-36(34-27(24)26)23-8-15-41-16-9-23/h5,10,17-20,23H,1-4,6-9,11-16H2,(H,32,38) |
| InChIKey | VMJCOJKQWHQSPW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |